C44H29N3 — CID 155764162
8-[4-(4-isocyanophenyl)phenyl]-6-(10-phenylphenanthren-9-yl)-4a,5-dihydropyrido[1,2-a]benzimidazole (PubChem CID 155764162) has the molecular formula C44H29N3 and a molecular weight of 599.74 g/mol. Its IUPAC name is 8-[4-(4-isocyanophenyl)phenyl]-6-(10-phenylphenanthren-9-yl)-4a,5-dihydropyrido[1,2-a]benzimidazole.
| Compound Name | 8-[4-(4-isocyanophenyl)phenyl]-6-(10-phenylphenanthren-9-yl)-4a,5-dihydropyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 155764162 |
| Molecular Formula | C44H29N3 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 8-[4-(4-isocyanophenyl)phenyl]-6-(10-phenylphenanthren-9-yl)-4a,5-dihydropyrido[1,2-a]benzimidazole |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3cc(-c4c(-c5ccccc5)c5ccccc5c5ccccc45)c4c(c3)N3C=CC=CC3N4)cc2)cc1 |
| InChI | InChI=1S/C44H29N3/c1-45-34-24-22-30(23-25-34)29-18-20-31(21-19-29)33-27-39(44-40(28-33)47-26-10-9-17-41(47)46-44)43-38-16-8-6-14-36(38)35-13-5-7-15-37(35)42(43)32-11-3-2-4-12-32/h2-28,41,46H |
| InChIKey | YCVDATHLKKDEPO-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 19.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|