C52H37N5 — CID 139543750
10-[4-[2,6-bis(3-phenylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]-15,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,16,18-nonaene (PubChem CID 139543750) has the molecular formula C52H37N5 and a molecular weight of 731.90 g/mol. Its IUPAC name is 10-[4-[2,6-bis(3-phenylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]-15,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,16,18-nonaene.
| Compound Name | 10-[4-[2,6-bis(3-phenylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]-15,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,16,18-nonaene |
|---|---|
| PubChem CID | 139543750 |
| Molecular Formula | C52H37N5 |
| Molecular Weight | 731.90 g/mol |
| Exact Mass | 731.30 |
| IUPAC Name | 10-[4-[2,6-bis(3-phenylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]phenyl]-15,21-diazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,16,18-nonaene |
| SMILES | C1=CC2Nc3c(c4ccc(-c5ccc(C6=NC(c7cccc(-c8ccccc8)c7)NC(c7cccc(-c8ccccc8)c7)=N6)cc5)cc4c4ccccc34)N2C=C1 |
| InChI | InChI=1S/C52H37N5/c1-3-13-34(14-4-1)38-17-11-19-41(31-38)51-54-50(55-52(56-51)42-20-12-18-39(32-42)35-15-5-2-6-16-35)37-26-24-36(25-27-37)40-28-29-45-46(33-40)43-21-7-8-22-44(43)48-49(45)57-30-10-9-23-47(57)53-48/h1-33,47,51,53H,(H,54,55,56) |
| InChIKey | JTQGWQSOUKPDCB-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.90 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|