C48H32N4 — CID 153394368
4-[3-[4-phenyl-6-[4-(10-phenylphenanthren-9-yl)phenyl]-1,2-dihydro-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 153394368) has the molecular formula C48H32N4 and a molecular weight of 664.81 g/mol. Its IUPAC name is 4-[3-[4-phenyl-6-[4-(10-phenylphenanthren-9-yl)phenyl]-1,2-dihydro-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 4-[3-[4-phenyl-6-[4-(10-phenylphenanthren-9-yl)phenyl]-1,2-dihydro-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 153394368 |
| Molecular Formula | C48H32N4 |
| Molecular Weight | 664.81 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | 4-[3-[4-phenyl-6-[4-(10-phenylphenanthren-9-yl)phenyl]-1,2-dihydro-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(C3N=C(c4ccccc4)N=C(c4ccc(-c5c(-c6ccccc6)c6ccccc6c6ccccc56)cc4)N3)c2)cc1 |
| InChI | InChI=1S/C48H32N4/c49-31-32-22-24-33(25-23-32)38-16-11-17-39(30-38)48-51-46(36-14-5-2-6-15-36)50-47(52-48)37-28-26-35(27-29-37)45-43-21-10-8-19-41(43)40-18-7-9-20-42(40)44(45)34-12-3-1-4-13-34/h1-30,48H,(H,50,51,52) |
| InChIKey | DWLJKYWWJIWHMV-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 60.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.81 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|