C28H36N6O4 — CID 155764616
4-[[(Z)-3-amino-2-[(1-cyclohexylpiperidin-4-yl)iminomethyl]prop-2-enyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 155764616) has the molecular formula C28H36N6O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is 4-[[(Z)-3-amino-2-[(1-cyclohexylpiperidin-4-yl)iminomethyl]prop-2-enyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[(Z)-3-amino-2-[(1-cyclohexylpiperidin-4-yl)iminomethyl]prop-2-enyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155764616 |
| Molecular Formula | C28H36N6O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 4-[[(Z)-3-amino-2-[(1-cyclohexylpiperidin-4-yl)iminomethyl]prop-2-enyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | N/C=C(\C=N\C1CCN(C2CCCCC2)CC1)CNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C28H36N6O4/c29-15-18(16-30-19-11-13-33(14-12-19)20-5-2-1-3-6-20)17-31-22-8-4-7-21-25(22)28(38)34(27(21)37)23-9-10-24(35)32-26(23)36/h4,7-8,15-16,19-20,23,31H,1-3,5-6,9-14,17,29H2,(H,32,35,36)/b18-15+,30-16+ |
| InChIKey | LQNWQURRPAWKCS-XTCQGECQSA-N |
| XLogP | 2.21 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|