C21H25N5O5 — CID 167815833
4-[[2-[(2R)-2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167815833) has the molecular formula C21H25N5O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-[[2-[(2R)-2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[2-[(2R)-2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167815833 |
| Molecular Formula | C21H25N5O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-[[2-[(2R)-2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NC[C@H]1CCCCN1C(=O)CNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H25N5O5/c22-10-12-4-1-2-9-25(12)17(28)11-23-14-6-3-5-13-18(14)21(31)26(20(13)30)15-7-8-16(27)24-19(15)29/h3,5-6,12,15,23H,1-2,4,7-11,22H2,(H,24,27,29)/t12-,15?/m1/s1 |
| InChIKey | LPTRMMHEBLNCAY-KEKZHRQWSA-N |
| XLogP | -0.16 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|