C24H23N5O5 — CID 166426119
4-[[2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166426119) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is 4-[[2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166426119 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 4-[[2-(7-amino-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1ccc2c(c1)N(C(=O)CNc1cccc3c1C(=O)N(C1CCC(=O)NC1=O)C3=O)CCC2 |
| InChI | InChI=1S/C24H23N5O5/c25-14-7-6-13-3-2-10-28(18(13)11-14)20(31)12-26-16-5-1-4-15-21(16)24(34)29(23(15)33)17-8-9-19(30)27-22(17)32/h1,4-7,11,17,26H,2-3,8-10,12,25H2,(H,27,30,32) |
| InChIKey | VHXAQKPKYHEDMN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|