C26H23N5O5 — CID 166426211
N-(6-cyano-1,2,3,4-tetrahydronaphthalen-1-yl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetamide (PubChem CID 166426211) has the molecular formula C26H23N5O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is N-(6-cyano-1,2,3,4-tetrahydronaphthalen-1-yl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetamide.
| Compound Name | N-(6-cyano-1,2,3,4-tetrahydronaphthalen-1-yl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 166426211 |
| Molecular Formula | C26H23N5O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-(6-cyano-1,2,3,4-tetrahydronaphthalen-1-yl)-2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetamide |
| SMILES | N#Cc1ccc2c(c1)CCCC2NC(=O)CNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H23N5O5/c27-12-14-7-8-16-15(11-14)3-1-5-18(16)29-22(33)13-28-19-6-2-4-17-23(19)26(36)31(25(17)35)20-9-10-21(32)30-24(20)34/h2,4,6-8,11,18,20,28H,1,3,5,9-10,13H2,(H,29,33)(H,30,32,34) |
| InChIKey | JBRQPZLSICXTOW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 148.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|