C19H28O3S3 — CID 155765053
2-methoxyethyl 2-ethyl-4-ethylsulfanylcarbothioylsulfanyl-2-methyl-4-phenylbutanoate (PubChem CID 155765053) has the molecular formula C19H28O3S3 and a molecular weight of 400.63 g/mol. Its IUPAC name is 2-methoxyethyl 2-ethyl-4-ethylsulfanylcarbothioylsulfanyl-2-methyl-4-phenylbutanoate.
| Compound Name | 2-methoxyethyl 2-ethyl-4-ethylsulfanylcarbothioylsulfanyl-2-methyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 155765053 |
| Molecular Formula | C19H28O3S3 |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-methoxyethyl 2-ethyl-4-ethylsulfanylcarbothioylsulfanyl-2-methyl-4-phenylbutanoate |
| SMILES | CCSC(=S)SC(CC(C)(CC)C(=O)OCCOC)c1ccccc1 |
| InChI | InChI=1S/C19H28O3S3/c1-5-19(3,17(20)22-13-12-21-4)14-16(25-18(23)24-6-2)15-10-8-7-9-11-15/h7-11,16H,5-6,12-14H2,1-4H3 |
| InChIKey | HETIORSFKPCFGG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|