C14H28NO3S+ — CID 155766327
butyl-[(3R)-3-carboxy-3-(2-methylbutanoylamino)propyl]-methylsulfanium (PubChem CID 155766327) has the molecular formula C14H28NO3S+ and a molecular weight of 290.45 g/mol. Its IUPAC name is butyl-[(3R)-3-carboxy-3-(2-methylbutanoylamino)propyl]-methylsulfanium.
| Compound Name | butyl-[(3R)-3-carboxy-3-(2-methylbutanoylamino)propyl]-methylsulfanium |
|---|---|
| PubChem CID | 155766327 |
| Molecular Formula | C14H28NO3S+ |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | butyl-[(3R)-3-carboxy-3-(2-methylbutanoylamino)propyl]-methylsulfanium |
| SMILES | CCCC[S+](C)CC[C@@H](NC(=O)C(C)CC)C(=O)O |
| InChI | InChI=1S/C14H27NO3S/c1-5-7-9-19(4)10-8-12(14(17)18)15-13(16)11(3)6-2/h11-12H,5-10H2,1-4H3,(H-,15,16,17,18)/p+1/t11?,12-,19?/m1/s1 |
| InChIKey | GRTGTZYGHPRAEU-DKXWOSEQSA-O |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|