C17H33N2O4S+ — CID 161314868
[(3R)-3-carboxy-3-[[5-(dimethylcarbamoyl)-2-methylheptanoyl]amino]propyl]-dimethylsulfanium (PubChem CID 161314868) has the molecular formula C17H33N2O4S+ and a molecular weight of 361.53 g/mol. Its IUPAC name is [(3R)-3-carboxy-3-[[5-(dimethylcarbamoyl)-2-methylheptanoyl]amino]propyl]-dimethylsulfanium.
| Compound Name | [(3R)-3-carboxy-3-[[5-(dimethylcarbamoyl)-2-methylheptanoyl]amino]propyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 161314868 |
| Molecular Formula | C17H33N2O4S+ |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | [(3R)-3-carboxy-3-[[5-(dimethylcarbamoyl)-2-methylheptanoyl]amino]propyl]-dimethylsulfanium |
| SMILES | CCC(CCC(C)C(=O)N[C@H](CC[S+](C)C)C(=O)O)C(=O)N(C)C |
| InChI | InChI=1S/C17H32N2O4S/c1-7-13(16(21)19(3)4)9-8-12(2)15(20)18-14(17(22)23)10-11-24(5)6/h12-14H,7-11H2,1-6H3,(H-,18,20,22,23)/p+1/t12?,13?,14-/m1/s1 |
| InChIKey | QPVBDIVLZYNFFX-JXQTWKCFSA-O |
| XLogP | 1.35 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|