C25H17F3N2O — CID 155772104
(3Z)-3-[1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methylidene]-7-methoxyindole (PubChem CID 155772104) has the molecular formula C25H17F3N2O and a molecular weight of 418.42 g/mol. Its IUPAC name is (3Z)-3-[1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methylidene]-7-methoxyindole.
| Compound Name | (3Z)-3-[1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methylidene]-7-methoxyindole |
|---|---|
| PubChem CID | 155772104 |
| Molecular Formula | C25H17F3N2O |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (3Z)-3-[1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methylidene]-7-methoxyindole |
| SMILES | COc1cccc2c1N=C/C2=C(/c1ccc(C(F)(F)F)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H17F3N2O/c1-31-22-8-4-6-18-20(14-30-24(18)22)23(15-9-11-16(12-10-15)25(26,27)28)19-13-29-21-7-3-2-5-17(19)21/h2-14,29H,1H3/b23-20+ |
| InChIKey | KPQHSOAUUGPZIJ-BSYVCWPDSA-N |
| XLogP | 6.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|