C24H15F3N2O2 — CID 155772110
(3Z)-3-[(5-hydroxy-1H-indol-3-yl)-[4-(trifluoromethyl)phenyl]methylidene]indol-5-ol (PubChem CID 155772110) has the molecular formula C24H15F3N2O2 and a molecular weight of 420.39 g/mol. Its IUPAC name is (3Z)-3-[(5-hydroxy-1H-indol-3-yl)-[4-(trifluoromethyl)phenyl]methylidene]indol-5-ol.
| Compound Name | (3Z)-3-[(5-hydroxy-1H-indol-3-yl)-[4-(trifluoromethyl)phenyl]methylidene]indol-5-ol |
|---|---|
| PubChem CID | 155772110 |
| Molecular Formula | C24H15F3N2O2 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (3Z)-3-[(5-hydroxy-1H-indol-3-yl)-[4-(trifluoromethyl)phenyl]methylidene]indol-5-ol |
| SMILES | Oc1ccc2c(c1)/C(=C(\c1ccc(C(F)(F)F)cc1)c1c[nH]c3ccc(O)cc13)C=N2 |
| InChI | InChI=1S/C24H15F3N2O2/c25-24(26,27)14-3-1-13(2-4-14)23(19-11-28-21-7-5-15(30)9-17(19)21)20-12-29-22-8-6-16(31)10-18(20)22/h1-12,28,30-31H/b23-20+ |
| InChIKey | JDTBYZKOIUXLOU-BSYVCWPDSA-N |
| XLogP | 6.27 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|