C27H22ClF3N2 — CID 164610260
(3Z)-3-[1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methylidene]-1-propylindol-1-ium chloride (PubChem CID 164610260) has the molecular formula C27H22ClF3N2 and a molecular weight of 466.93 g/mol. Its IUPAC name is (3Z)-3-[1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methylidene]-1-propylindol-1-ium chloride.
| Compound Name | (3Z)-3-[1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methylidene]-1-propylindol-1-ium chloride |
|---|---|
| PubChem CID | 164610260 |
| Molecular Formula | C27H22ClF3N2 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | (3Z)-3-[1H-indol-3-yl-[4-(trifluoromethyl)phenyl]methylidene]-1-propylindol-1-ium chloride |
| SMILES | CCC[N+]1=C/C(=C(/c2ccc(C(F)(F)F)cc2)c2c[nH]c3ccccc23)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C27H21F3N2.ClH/c1-2-15-32-17-23(21-8-4-6-10-25(21)32)26(18-11-13-19(14-12-18)27(28,29)30)22-16-31-24-9-5-3-7-20(22)24;/h3-14,16-17H,2,15H2,1H3;1H |
| InChIKey | TWXRABJYDDQBNM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 18.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|