C24H16F3N2O+ — CID 162212810
4-[indol-1-ium-3-ylidene(1H-indol-3-yl)methyl]-2-(trifluoromethyl)phenol (PubChem CID 162212810) has the molecular formula C24H16F3N2O+ and a molecular weight of 405.40 g/mol. Its IUPAC name is 4-[indol-1-ium-3-ylidene(1H-indol-3-yl)methyl]-2-(trifluoromethyl)phenol.
| Compound Name | 4-[indol-1-ium-3-ylidene(1H-indol-3-yl)methyl]-2-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 162212810 |
| Molecular Formula | C24H16F3N2O+ |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 4-[indol-1-ium-3-ylidene(1H-indol-3-yl)methyl]-2-(trifluoromethyl)phenol |
| SMILES | Oc1ccc(C(=C2C=[NH+]c3ccccc32)c2c[nH]c3ccccc23)cc1C(F)(F)F |
| InChI | InChI=1S/C24H15F3N2O/c25-24(26,27)19-11-14(9-10-22(19)30)23(17-12-28-20-7-3-1-5-15(17)20)18-13-29-21-8-4-2-6-16(18)21/h1-13,28,30H/p+1 |
| InChIKey | XDBOJLZTAYKHBJ-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 49.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|