C25H19N2O3+ — CID 155772278
3-[(Z)-indol-1-ium-3-ylidene-(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1H-indole (PubChem CID 155772278) has the molecular formula C25H19N2O3+ and a molecular weight of 395.44 g/mol. Its IUPAC name is 3-[(Z)-indol-1-ium-3-ylidene-(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1H-indole.
| Compound Name | 3-[(Z)-indol-1-ium-3-ylidene-(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 155772278 |
| Molecular Formula | C25H19N2O3+ |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3-[(Z)-indol-1-ium-3-ylidene-(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1H-indole |
| SMILES | COc1cc(/C(=C2/C=[NH+]c3ccccc32)c2c[nH]c3ccccc23)cc2c1OCO2 |
| InChI | InChI=1S/C25H18N2O3/c1-28-22-10-15(11-23-25(22)30-14-29-23)24(18-12-26-20-8-4-2-6-16(18)20)19-13-27-21-9-5-3-7-17(19)21/h2-13,26H,14H2,1H3/p+1/b24-19+ |
| InChIKey | FSEHPNZKASEVCI-LYBHJNIJSA-O |
| XLogP | 3.66 |
| TPSA | 57.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|