C8H10F4O3 — CID 155774744
2-hydroxypent-4-enyl 2,3,3,3-tetrafluoropropanoate (PubChem CID 155774744) has the molecular formula C8H10F4O3 and a molecular weight of 230.16 g/mol. Its IUPAC name is 2-hydroxypent-4-enyl 2,3,3,3-tetrafluoropropanoate.
| Compound Name | 2-hydroxypent-4-enyl 2,3,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 155774744 |
| Molecular Formula | C8H10F4O3 |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-hydroxypent-4-enyl 2,3,3,3-tetrafluoropropanoate |
| SMILES | C=CCC(O)COC(=O)C(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F4O3/c1-2-3-5(13)4-15-7(14)6(9)8(10,11)12/h2,5-6,13H,1,3-4H2 |
| InChIKey | CABZIPGUYTXAMH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|