C5H3ClF4O2 — CID 175302669
1-chloroethenyl 2,3,3,3-tetrafluoropropanoate (PubChem CID 175302669) has the molecular formula C5H3ClF4O2 and a molecular weight of 206.52 g/mol. Its IUPAC name is 1-chloroethenyl 2,3,3,3-tetrafluoropropanoate.
| Compound Name | 1-chloroethenyl 2,3,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 175302669 |
| Molecular Formula | C5H3ClF4O2 |
| Molecular Weight | 206.52 g/mol |
| Exact Mass | 205.98 |
| IUPAC Name | 1-chloroethenyl 2,3,3,3-tetrafluoropropanoate |
| SMILES | C=C(Cl)OC(=O)C(F)C(F)(F)F |
| InChI | InChI=1S/C5H3ClF4O2/c1-2(6)12-4(11)3(7)5(8,9)10/h3H,1H2 |
| InChIKey | NHSWHOIWEPABKO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|