C7H6F7NO — CID 87371239
3,4,4,5,5,6,6-heptafluoro-2-methylidenehexanamide (PubChem CID 87371239) has the molecular formula C7H6F7NO and a molecular weight of 253.12 g/mol. Its IUPAC name is 3,4,4,5,5,6,6-heptafluoro-2-methylidenehexanamide.
| Compound Name | 3,4,4,5,5,6,6-heptafluoro-2-methylidenehexanamide |
|---|---|
| PubChem CID | 87371239 |
| Molecular Formula | C7H6F7NO |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 3,4,4,5,5,6,6-heptafluoro-2-methylidenehexanamide |
| SMILES | C=C(C(N)=O)C(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H6F7NO/c1-2(4(15)16)3(8)6(11,12)7(13,14)5(9)10/h3,5H,1H2,(H2,15,16) |
| InChIKey | ALGLEPFYUBIXSI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|