C8H2F12O — CID 18348280
1,1,3,4,4,4-hexafluoro-2-(1,1,3,4,4,4-hexafluorobut-1-en-2-yloxy)but-1-ene (PubChem CID 18348280) has the molecular formula C8H2F12O and a molecular weight of 342.08 g/mol. Its IUPAC name is 1,1,3,4,4,4-hexafluoro-2-(1,1,3,4,4,4-hexafluorobut-1-en-2-yloxy)but-1-ene.
| Compound Name | 1,1,3,4,4,4-hexafluoro-2-(1,1,3,4,4,4-hexafluorobut-1-en-2-yloxy)but-1-ene |
|---|---|
| PubChem CID | 18348280 |
| Molecular Formula | C8H2F12O |
| Molecular Weight | 342.08 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 1,1,3,4,4,4-hexafluoro-2-(1,1,3,4,4,4-hexafluorobut-1-en-2-yloxy)but-1-ene |
| SMILES | FC(F)=C(OC(=C(F)F)C(F)C(F)(F)F)C(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F12O/c9-3(7(15,16)17)1(5(11)12)21-2(6(13)14)4(10)8(18,19)20/h3-4H |
| InChIKey | LFRGQYUQRQQDKF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.08 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|