C11H8Cl12O2 — CID 155776476
1,1,2,2,3,3,4,4,5,7,7,7-dodecachloroheptyl 2-methylprop-2-enoate (PubChem CID 155776476) has the molecular formula C11H8Cl12O2 and a molecular weight of 597.62 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,7,7,7-dodecachloroheptyl 2-methylprop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,7,7,7-dodecachloroheptyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155776476 |
| Molecular Formula | C11H8Cl12O2 |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 591.68 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,7,7,7-dodecachloroheptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H8Cl12O2/c1-4(2)6(24)25-11(22,23)10(20,21)9(18,19)8(16,17)5(12)3-7(13,14)15/h5H,1,3H2,2H3 |
| InChIKey | QYSISNKAXXFRMN-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|