C12H5Cl17O2 — CID 172707833
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecachlorooctyl 2-methylprop-2-enoate (PubChem CID 172707833) has the molecular formula C12H5Cl17O2 and a molecular weight of 783.87 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecachlorooctyl 2-methylprop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecachlorooctyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 172707833 |
| Molecular Formula | C12H5Cl17O2 |
| Molecular Weight | 783.87 g/mol |
| Exact Mass | 775.50 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecachlorooctyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H5Cl17O2/c1-3(2)4(30)31-12(28,29)10(23,24)8(19,20)6(15,16)5(13,14)7(17,18)9(21,22)11(25,26)27/h1H2,2H3 |
| InChIKey | DVKOLCFDVXWIKO-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.87 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|