C6H12O6P2S2 — CID 91322231
1,1-bis(dihydroxyphosphinothioyl)ethyl 2-methylprop-2-enoate (PubChem CID 91322231) has the molecular formula C6H12O6P2S2 and a molecular weight of 306.24 g/mol. Its IUPAC name is 1,1-bis(dihydroxyphosphinothioyl)ethyl 2-methylprop-2-enoate.
| Compound Name | 1,1-bis(dihydroxyphosphinothioyl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91322231 |
| Molecular Formula | C6H12O6P2S2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 1,1-bis(dihydroxyphosphinothioyl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(P(O)(O)=S)P(O)(O)=S |
| InChI | InChI=1S/C6H12O6P2S2/c1-4(2)5(7)12-6(3,13(8,9)15)14(10,11)16/h1H2,2-3H3,(H2,8,9,15)(H2,10,11,16) |
| InChIKey | ZHXDNZWIKUXWCI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|