C25H27N3OS — CID 155780941
2-(6-azaspiro[2.5]octan-6-yl)-N-(4-methylquinolin-8-yl)-4-methylsulfanylbenzamide (PubChem CID 155780941) has the molecular formula C25H27N3OS and a molecular weight of 417.58 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-(4-methylquinolin-8-yl)-4-methylsulfanylbenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-(4-methylquinolin-8-yl)-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 155780941 |
| Molecular Formula | C25H27N3OS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-(4-methylquinolin-8-yl)-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)Nc2cccc3c(C)ccnc23)c(N2CCC3(CC2)CC3)c1 |
| InChI | InChI=1S/C25H27N3OS/c1-17-8-13-26-23-19(17)4-3-5-21(23)27-24(29)20-7-6-18(30-2)16-22(20)28-14-11-25(9-10-25)12-15-28/h3-8,13,16H,9-12,14-15H2,1-2H3,(H,27,29) |
| InChIKey | OAFHYLAIMABOSY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |