C19H22ClN3OS — CID 8834278
2-chloro-N-[2-(4-methylpiperazin-1-yl)phenyl]-5-methylsulfanylbenzamide (PubChem CID 8834278) has the molecular formula C19H22ClN3OS and a molecular weight of 375.93 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-methylpiperazin-1-yl)phenyl]-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-[2-(4-methylpiperazin-1-yl)phenyl]-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 8834278 |
| Molecular Formula | C19H22ClN3OS |
| Molecular Weight | 375.93 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-chloro-N-[2-(4-methylpiperazin-1-yl)phenyl]-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)Nc2ccccc2N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C19H22ClN3OS/c1-22-9-11-23(12-10-22)18-6-4-3-5-17(18)21-19(24)15-13-14(25-2)7-8-16(15)20/h3-8,13H,9-12H2,1-2H3,(H,21,24) |
| InChIKey | CGUGJVOZBDPZAX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.93 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |