C15H16Br2O4S — CID 15578368
ethyl 5,6-dibromo-6-(4-methylsulfanylphenyl)-2,4-dioxohexanoate (PubChem CID 15578368) has the molecular formula C15H16Br2O4S and a molecular weight of 452.16 g/mol. Its IUPAC name is ethyl 5,6-dibromo-6-(4-methylsulfanylphenyl)-2,4-dioxohexanoate.
| Compound Name | ethyl 5,6-dibromo-6-(4-methylsulfanylphenyl)-2,4-dioxohexanoate |
|---|---|
| PubChem CID | 15578368 |
| Molecular Formula | C15H16Br2O4S |
| Molecular Weight | 452.16 g/mol |
| Exact Mass | 449.91 |
| IUPAC Name | ethyl 5,6-dibromo-6-(4-methylsulfanylphenyl)-2,4-dioxohexanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)C(Br)C(Br)c1ccc(SC)cc1 |
| InChI | InChI=1S/C15H16Br2O4S/c1-3-21-15(20)12(19)8-11(18)14(17)13(16)9-4-6-10(22-2)7-5-9/h4-7,13-14H,3,8H2,1-2H3 |
| InChIKey | WCKYSNMKOPLJET-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|