C21H19I2O6- — CID 155784810
3,3-bis[4-(2-iodopropanoyloxy)phenyl]propanoate (PubChem CID 155784810) has the molecular formula C21H19I2O6- and a molecular weight of 621.19 g/mol. Its IUPAC name is 3,3-bis[4-(2-iodopropanoyloxy)phenyl]propanoate.
| Compound Name | 3,3-bis[4-(2-iodopropanoyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 155784810 |
| Molecular Formula | C21H19I2O6- |
| Molecular Weight | 621.19 g/mol |
| Exact Mass | 620.93 |
| IUPAC Name | 3,3-bis[4-(2-iodopropanoyloxy)phenyl]propanoate |
| SMILES | CC(I)C(=O)Oc1ccc(C(CC(=O)[O-])c2ccc(OC(=O)C(C)I)cc2)cc1 |
| InChI | InChI=1S/C21H20I2O6/c1-12(22)20(26)28-16-7-3-14(4-8-16)18(11-19(24)25)15-5-9-17(10-6-15)29-21(27)13(2)23/h3-10,12-13,18H,11H2,1-2H3,(H,24,25)/p-1 |
| InChIKey | DWPHETXDUKBIIX-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|