C21H24FNaO3 — CID 42603098
sodium 3-[4-(2-ethylbutoxy)phenyl]-3-(4-fluorophenyl)propanoate (PubChem CID 42603098) has the molecular formula C21H24FNaO3 and a molecular weight of 366.41 g/mol. Its IUPAC name is sodium 3-[4-(2-ethylbutoxy)phenyl]-3-(4-fluorophenyl)propanoate.
| Compound Name | sodium 3-[4-(2-ethylbutoxy)phenyl]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 42603098 |
| Molecular Formula | C21H24FNaO3 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | sodium 3-[4-(2-ethylbutoxy)phenyl]-3-(4-fluorophenyl)propanoate |
| SMILES | CCC(CC)COc1ccc(C(CC(=O)[O-])c2ccc(F)cc2)cc1.[Na+] |
| InChI | InChI=1S/C21H25FO3.Na/c1-3-15(4-2)14-25-19-11-7-17(8-12-19)20(13-21(23)24)16-5-9-18(22)10-6-16;/h5-12,15,20H,3-4,13-14H2,1-2H3,(H,23,24);/q;+1/p-1 |
| InChIKey | KIHKDEXQXXXNIA-UHFFFAOYSA-M |
| XLogP | 0.92 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |