C27H50N+ — CID 155788524
[10,13-dimethyl-15-(4-methylphenyl)pentadecyl]-trimethylazanium (PubChem CID 155788524) has the molecular formula C27H50N+ and a molecular weight of 388.70 g/mol. Its IUPAC name is [10,13-dimethyl-15-(4-methylphenyl)pentadecyl]-trimethylazanium.
| Compound Name | [10,13-dimethyl-15-(4-methylphenyl)pentadecyl]-trimethylazanium |
|---|---|
| PubChem CID | 155788524 |
| Molecular Formula | C27H50N+ |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.39 |
| IUPAC Name | [10,13-dimethyl-15-(4-methylphenyl)pentadecyl]-trimethylazanium |
| SMILES | Cc1ccc(CCC(C)CCC(C)CCCCCCCCC[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C27H50N/c1-24(14-12-10-8-7-9-11-13-23-28(4,5)6)15-16-25(2)17-20-27-21-18-26(3)19-22-27/h18-19,21-22,24-25H,7-17,20,23H2,1-6H3/q+1 |
| InChIKey | OAFYAQINQFMWDC-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|