C12H14N4O2 — CID 155790127
2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane-6,8-dione (PubChem CID 155790127) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane-6,8-dione.
| Compound Name | 2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane-6,8-dione |
|---|---|
| PubChem CID | 155790127 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-pyrimidin-2-yl-2,7-diazaspiro[4.5]decane-6,8-dione |
| SMILES | O=C1CCC2(CCN(c3ncccn3)C2)C(=O)N1 |
| InChI | InChI=1S/C12H14N4O2/c17-9-2-3-12(10(18)15-9)4-7-16(8-12)11-13-5-1-6-14-11/h1,5-6H,2-4,7-8H2,(H,15,17,18) |
| InChIKey | QYZNHSPBPSCIKZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|