C15H11N3O8 — CID 155793779
(3aR,4R,7R,7aS)-4-(hydroxymethyl)-7-nitro-2-(4-nitrophenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 155793779) has the molecular formula C15H11N3O8 and a molecular weight of 361.27 g/mol. Its IUPAC name is (3aR,4R,7R,7aS)-4-(hydroxymethyl)-7-nitro-2-(4-nitrophenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,7aS)-4-(hydroxymethyl)-7-nitro-2-(4-nitrophenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 155793779 |
| Molecular Formula | C15H11N3O8 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (3aR,4R,7R,7aS)-4-(hydroxymethyl)-7-nitro-2-(4-nitrophenyl)-3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccc([N+](=O)[O-])cc1)[C@@]1([N+](=O)[O-])C=C[C@@]2(CO)O1 |
| InChI | InChI=1S/C15H11N3O8/c19-7-14-5-6-15(26-14,18(24)25)11-10(14)12(20)16(13(11)21)8-1-3-9(4-2-8)17(22)23/h1-6,10-11,19H,7H2/t10-,11+,14-,15+/m0/s1 |
| InChIKey | BEOYAMAJSXCEJJ-IDTSFGKNSA-N |
| XLogP | 0.00 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|