C4H10N2O2S — CID 155797098
N,N-dimethyl-1-methylsulfonylmethanimidamide (PubChem CID 155797098) has the molecular formula C4H10N2O2S and a molecular weight of 150.20 g/mol. Its IUPAC name is N,N-dimethyl-1-methylsulfonylmethanimidamide.
| Compound Name | N,N-dimethyl-1-methylsulfonylmethanimidamide |
|---|---|
| PubChem CID | 155797098 |
| Molecular Formula | C4H10N2O2S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | N,N-dimethyl-1-methylsulfonylmethanimidamide |
| SMILES | [H]/N=C(\N(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C4H10N2O2S/c1-6(2)4(5)9(3,7)8/h5H,1-3H3/b5-4+ |
| InChIKey | FGZUSDHLGWASCJ-SNAWJCMRSA-N |
| XLogP | -0.47 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|