C8H18F3N3O3S — CID 160616399
(N,N-dimethylcarbamimidoyl)-ethyl-dimethylazanium;trifluoromethanesulfonate (PubChem CID 160616399) has the molecular formula C8H18F3N3O3S and a molecular weight of 293.31 g/mol. Its IUPAC name is (N,N-dimethylcarbamimidoyl)-ethyl-dimethylazanium;trifluoromethanesulfonate.
| Compound Name | (N,N-dimethylcarbamimidoyl)-ethyl-dimethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160616399 |
| Molecular Formula | C8H18F3N3O3S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (N,N-dimethylcarbamimidoyl)-ethyl-dimethylazanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.[H]/N=C(\N(C)C)[N+](C)(C)CC |
| InChI | InChI=1S/C7H18N3.CHF3O3S/c1-6-10(4,5)7(8)9(2)3;2-1(3,4)8(5,6)7/h8H,6H2,1-5H3;(H,5,6,7)/q+1;/p-1/b8-7+; |
| InChIKey | RGDMKELMUOLMSM-USRGLUTNSA-M |
| XLogP | 0.63 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|