C26H23N7O5S — CID 155797295
(3S)-3-[(3aR)-3-(4-nitrophenyl)sulfonyl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indol-8b-yl]-3-(2-azidoethyl)-1H-indol-2-one (PubChem CID 155797295) has the molecular formula C26H23N7O5S and a molecular weight of 545.58 g/mol. Its IUPAC name is (3S)-3-[(3aR)-3-(4-nitrophenyl)sulfonyl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indol-8b-yl]-3-(2-azidoethyl)-1H-indol-2-one.
| Compound Name | (3S)-3-[(3aR)-3-(4-nitrophenyl)sulfonyl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indol-8b-yl]-3-(2-azidoethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 155797295 |
| Molecular Formula | C26H23N7O5S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | (3S)-3-[(3aR)-3-(4-nitrophenyl)sulfonyl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indol-8b-yl]-3-(2-azidoethyl)-1H-indol-2-one |
| SMILES | [N-]=[N+]=NCC[C@]1(C23CCN(S(=O)(=O)c4ccc([N+](=O)[O-])cc4)[C@H]2Nc2ccccc23)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C26H23N7O5S/c27-31-28-15-13-26(20-6-2-4-8-22(20)30-24(26)34)25-14-16-32(23(25)29-21-7-3-1-5-19(21)25)39(37,38)18-11-9-17(10-12-18)33(35)36/h1-12,23,29H,13-16H2,(H,30,34)/t23-,25?,26-/m1/s1 |
| InChIKey | XGSCAIVCLHPYQB-UVAYFRITSA-N |
| XLogP | 4.27 |
| TPSA | 170.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|