C19H17N3O4S — CID 54589736
(3aS,8bS)-3-(2-nitrophenyl)sulfonyl-8b-prop-2-ynyl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole (PubChem CID 54589736) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is (3aS,8bS)-3-(2-nitrophenyl)sulfonyl-8b-prop-2-ynyl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole.
| Compound Name | (3aS,8bS)-3-(2-nitrophenyl)sulfonyl-8b-prop-2-ynyl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 54589736 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (3aS,8bS)-3-(2-nitrophenyl)sulfonyl-8b-prop-2-ynyl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole |
| SMILES | C#CC[C@@]12CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])[C@@H]1Nc1ccccc12 |
| InChI | InChI=1S/C19H17N3O4S/c1-2-11-19-12-13-21(18(19)20-15-8-4-3-7-14(15)19)27(25,26)17-10-6-5-9-16(17)22(23)24/h1,3-10,18,20H,11-13H2/t18-,19-/m0/s1 |
| InChIKey | WLSKIIRRYJYCOD-OALUTQOASA-N |
| XLogP | 2.70 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|