C27H54O5Si — CID 155797348
8-[tris(2,2-dimethylpropoxy)silyl]octyl but-2-enoate (PubChem CID 155797348) has the molecular formula C27H54O5Si and a molecular weight of 486.81 g/mol. Its IUPAC name is 8-[tris(2,2-dimethylpropoxy)silyl]octyl but-2-enoate.
| Compound Name | 8-[tris(2,2-dimethylpropoxy)silyl]octyl but-2-enoate |
|---|---|
| PubChem CID | 155797348 |
| Molecular Formula | C27H54O5Si |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | 8-[tris(2,2-dimethylpropoxy)silyl]octyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCCCCCC[Si](OCC(C)(C)C)(OCC(C)(C)C)OCC(C)(C)C |
| InChI | InChI=1S/C27H54O5Si/c1-11-18-24(28)29-19-16-14-12-13-15-17-20-33(30-21-25(2,3)4,31-22-26(5,6)7)32-23-27(8,9)10/h11,18H,12-17,19-23H2,1-10H3 |
| InChIKey | HWPYDRCSUNBURJ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|