C23H28O12S — CID 155797679
1-deuterio-3-hydroxy-3-[(2R,3R,4S,5R)-3,4,5-tris(2-deuterio-2-oxoethyl)-3,4,5,6-tetrahydroxy-6-(2-phenylprop-2-enylsulfonyl)oxan-2-yl]propan-1-one (PubChem CID 155797679) has the molecular formula C23H28O12S and a molecular weight of 532.56 g/mol. Its IUPAC name is 1-deuterio-3-hydroxy-3-[(2R,3R,4S,5R)-3,4,5-tris(2-deuterio-2-oxoethyl)-3,4,5,6-tetrahydroxy-6-(2-phenylprop-2-enylsulfonyl)oxan-2-yl]propan-1-one.
| Compound Name | 1-deuterio-3-hydroxy-3-[(2R,3R,4S,5R)-3,4,5-tris(2-deuterio-2-oxoethyl)-3,4,5,6-tetrahydroxy-6-(2-phenylprop-2-enylsulfonyl)oxan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 155797679 |
| Molecular Formula | C23H28O12S |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 1-deuterio-3-hydroxy-3-[(2R,3R,4S,5R)-3,4,5-tris(2-deuterio-2-oxoethyl)-3,4,5,6-tetrahydroxy-6-(2-phenylprop-2-enylsulfonyl)oxan-2-yl]propan-1-one |
| SMILES | [2H]C(=O)CC(O)[C@H]1OC(O)(S(=O)(=O)CC(=C)c2ccccc2)[C@@](O)(CC([2H])=O)[C@](O)(CC([2H])=O)[C@@]1(O)CC([2H])=O |
| InChI | InChI=1S/C23H28O12S/c1-16(17-5-3-2-4-6-17)15-36(33,34)23(32)22(31,10-14-27)21(30,9-13-26)20(29,8-12-25)19(35-23)18(28)7-11-24/h2-6,11-14,18-19,28-32H,1,7-10,15H2/t18?,19-,20-,21+,22-,23?/m1/s1/i11D,12D,13D,14D |
| InChIKey | VHAHOTLQTLHPOO-PFWVYWOTSA-N |
| XLogP | -1.93 |
| TPSA | 212.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|