C18H24O10S — CID 101242586
dimethyl 2-[(2R,3S,4R,5R,6R)-4-(benzenesulfonyl)-5-hydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]propanedioate (PubChem CID 101242586) has the molecular formula C18H24O10S and a molecular weight of 432.45 g/mol. Its IUPAC name is dimethyl 2-[(2R,3S,4R,5R,6R)-4-(benzenesulfonyl)-5-hydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(2R,3S,4R,5R,6R)-4-(benzenesulfonyl)-5-hydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]propanedioate |
|---|---|
| PubChem CID | 101242586 |
| Molecular Formula | C18H24O10S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | dimethyl 2-[(2R,3S,4R,5R,6R)-4-(benzenesulfonyl)-5-hydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1[C@H](OC)O[C@H](CO)[C@@H](O)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24O10S/c1-25-16(21)13(17(22)26-2)12-15(14(20)11(9-19)28-18(12)27-3)29(23,24)10-7-5-4-6-8-10/h4-8,11-15,18-20H,9H2,1-3H3/t11-,12-,14-,15-,18-/m1/s1 |
| InChIKey | XBZXVHAWOVHISQ-AJKMGBEJSA-N |
| XLogP | -0.87 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|