C29H38O9S — CID 90691173
6-[6-(2-benzylsulfinylethyl)-8-phenyloctanoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 90691173) has the molecular formula C29H38O9S and a molecular weight of 562.68 g/mol. Its IUPAC name is 6-[6-(2-benzylsulfinylethyl)-8-phenyloctanoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[6-(2-benzylsulfinylethyl)-8-phenyloctanoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90691173 |
| Molecular Formula | C29H38O9S |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 6-[6-(2-benzylsulfinylethyl)-8-phenyloctanoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(CCCCC(CCc1ccccc1)CCS(=O)Cc1ccccc1)OC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C29H38O9S/c30-23(37-29-26(33)24(31)25(32)27(38-29)28(34)35)14-8-7-11-21(16-15-20-9-3-1-4-10-20)17-18-39(36)19-22-12-5-2-6-13-22/h1-6,9-10,12-13,21,24-27,29,31-33H,7-8,11,14-19H2,(H,34,35) |
| InChIKey | IXGBMQFYFZSVKH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|