C31H42O8S2 — CID 91176017
5-(8-benzylsulfanyl-6-benzylsulfinyloctanoyl)oxy-4-ethoxy-2,3-dihydroxycyclohexane-1-carboxylic acid (PubChem CID 91176017) has the molecular formula C31H42O8S2 and a molecular weight of 606.80 g/mol. Its IUPAC name is 5-(8-benzylsulfanyl-6-benzylsulfinyloctanoyl)oxy-4-ethoxy-2,3-dihydroxycyclohexane-1-carboxylic acid.
| Compound Name | 5-(8-benzylsulfanyl-6-benzylsulfinyloctanoyl)oxy-4-ethoxy-2,3-dihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 91176017 |
| Molecular Formula | C31H42O8S2 |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 5-(8-benzylsulfanyl-6-benzylsulfinyloctanoyl)oxy-4-ethoxy-2,3-dihydroxycyclohexane-1-carboxylic acid |
| SMILES | CCOC1C(OC(=O)CCCCC(CCSCc2ccccc2)S(=O)Cc2ccccc2)CC(C(=O)O)C(O)C1O |
| InChI | InChI=1S/C31H42O8S2/c1-2-38-30-26(19-25(31(35)36)28(33)29(30)34)39-27(32)16-10-9-15-24(41(37)21-23-13-7-4-8-14-23)17-18-40-20-22-11-5-3-6-12-22/h3-8,11-14,24-26,28-30,33-34H,2,9-10,15-21H2,1H3,(H,35,36) |
| InChIKey | PXXACLRFQWYDGT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|