C28H36O9S2 — CID 46917538
6-(6-benzylsulfanyl-8-benzylsulfinyloctanoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 46917538) has the molecular formula C28H36O9S2 and a molecular weight of 580.72 g/mol. Its IUPAC name is 6-(6-benzylsulfanyl-8-benzylsulfinyloctanoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(6-benzylsulfanyl-8-benzylsulfinyloctanoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 46917538 |
| Molecular Formula | C28H36O9S2 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 6-(6-benzylsulfanyl-8-benzylsulfinyloctanoyl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(CCCCC(CCS(=O)Cc1ccccc1)SCc1ccccc1)OC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C28H36O9S2/c29-22(36-28-25(32)23(30)24(31)26(37-28)27(33)34)14-8-7-13-21(38-17-19-9-3-1-4-10-19)15-16-39(35)18-20-11-5-2-6-12-20/h1-6,9-12,21,23-26,28,30-32H,7-8,13-18H2,(H,33,34) |
| InChIKey | GOORRUOJZYBWPS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|