C29H38O7S2 — CID 91369558
6-[6,8-bis(benzylsulfanyl)octanoyloxy]-3,4-dihydroxy-5-methyloxane-2-carboxylic acid (PubChem CID 91369558) has the molecular formula C29H38O7S2 and a molecular weight of 562.75 g/mol. Its IUPAC name is 6-[6,8-bis(benzylsulfanyl)octanoyloxy]-3,4-dihydroxy-5-methyloxane-2-carboxylic acid.
| Compound Name | 6-[6,8-bis(benzylsulfanyl)octanoyloxy]-3,4-dihydroxy-5-methyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91369558 |
| Molecular Formula | C29H38O7S2 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 6-[6,8-bis(benzylsulfanyl)octanoyloxy]-3,4-dihydroxy-5-methyloxane-2-carboxylic acid |
| SMILES | CC1C(OC(=O)CCCCC(CCSCc2ccccc2)SCc2ccccc2)OC(C(=O)O)C(O)C1O |
| InChI | InChI=1S/C29H38O7S2/c1-20-25(31)26(32)27(28(33)34)36-29(20)35-24(30)15-9-8-14-23(38-19-22-12-6-3-7-13-22)16-17-37-18-21-10-4-2-5-11-21/h2-7,10-13,20,23,25-27,29,31-32H,8-9,14-19H2,1H3,(H,33,34) |
| InChIKey | YCPUIYOZKWOOFU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|