C17H18N4OS — CID 155801216
1-[2-[4-(2-methylpyrazol-3-yl)phenyl]ethyl]-3-thiophen-2-ylurea (PubChem CID 155801216) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 1-[2-[4-(2-methylpyrazol-3-yl)phenyl]ethyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[2-[4-(2-methylpyrazol-3-yl)phenyl]ethyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 155801216 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[2-[4-(2-methylpyrazol-3-yl)phenyl]ethyl]-3-thiophen-2-ylurea |
| SMILES | Cn1nccc1-c1ccc(CCNC(=O)Nc2cccs2)cc1 |
| InChI | InChI=1S/C17H18N4OS/c1-21-15(9-11-19-21)14-6-4-13(5-7-14)8-10-18-17(22)20-16-3-2-12-23-16/h2-7,9,11-12H,8,10H2,1H3,(H2,18,20,22) |
| InChIKey | OLMAWLCSVLLBJY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |