C24H30ClN5O — CID 155802874
N-[2-chloro-5-(pyrrolidin-1-ylmethyl)phenyl]-5-pyridin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 155802874) has the molecular formula C24H30ClN5O and a molecular weight of 439.99 g/mol. Its IUPAC name is N-[2-chloro-5-(pyrrolidin-1-ylmethyl)phenyl]-5-pyridin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[2-chloro-5-(pyrrolidin-1-ylmethyl)phenyl]-5-pyridin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 155802874 |
| Molecular Formula | C24H30ClN5O |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[2-chloro-5-(pyrrolidin-1-ylmethyl)phenyl]-5-pyridin-3-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1cc(CN2CCCC2)ccc1Cl)C1NNC2CCC(c3cccnc3)CC21 |
| InChI | InChI=1S/C24H30ClN5O/c25-20-7-5-16(15-30-10-1-2-11-30)12-22(20)27-24(31)23-19-13-17(6-8-21(19)28-29-23)18-4-3-9-26-14-18/h3-5,7,9,12,14,17,19,21,23,28-29H,1-2,6,8,10-11,13,15H2,(H,27,31) |
| InChIKey | HADFKRCTZARJAL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |