C14H18N6O — CID 155803036
N-(1-cyanopyrrolidin-3-yl)-5-pyridin-4-ylpyrazolidine-3-carboxamide (PubChem CID 155803036) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-5-pyridin-4-ylpyrazolidine-3-carboxamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-5-pyridin-4-ylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 155803036 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-5-pyridin-4-ylpyrazolidine-3-carboxamide |
| SMILES | N#CN1CCC(NC(=O)C2CC(c3ccncc3)NN2)C1 |
| InChI | InChI=1S/C14H18N6O/c15-9-20-6-3-11(8-20)17-14(21)13-7-12(18-19-13)10-1-4-16-5-2-10/h1-2,4-5,11-13,18-19H,3,6-8H2,(H,17,21) |
| InChIKey | LODUHQGLVBWODT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|