C10H6N4 — CID 155803289
2,4,5,10-tetrazatricyclo[7.5.0.03,7]tetradeca-1(14),2,4,6,8,10,12-heptaene (PubChem CID 155803289) has the molecular formula C10H6N4 and a molecular weight of 182.19 g/mol. Its IUPAC name is 2,4,5,10-tetrazatricyclo[7.5.0.03,7]tetradeca-1(14),2,4,6,8,10,12-heptaene.
| Compound Name | 2,4,5,10-tetrazatricyclo[7.5.0.03,7]tetradeca-1(14),2,4,6,8,10,12-heptaene |
|---|---|
| PubChem CID | 155803289 |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2,4,5,10-tetrazatricyclo[7.5.0.03,7]tetradeca-1(14),2,4,6,8,10,12-heptaene |
| SMILES | c1ccc2nc3nncc3cc2nc1 |
| InChI | InChI=1S/C10H6N4/c1-2-4-11-9-5-7-6-12-14-10(7)13-8(9)3-1/h1-6H |
| InChIKey | LGOYWLBSEWGIPH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |