C76H90N8O4 — CID 155803633
5,10,15,20-tetrakis[4-[2-(2-methylpiperidin-1-yl)ethoxy]phenyl]-21,23-dihydroporphyrin (PubChem CID 155803633) has the molecular formula C76H90N8O4 and a molecular weight of 1179.61 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[4-[2-(2-methylpiperidin-1-yl)ethoxy]phenyl]-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[4-[2-(2-methylpiperidin-1-yl)ethoxy]phenyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 155803633 |
| Molecular Formula | C76H90N8O4 |
| Molecular Weight | 1179.61 g/mol |
| Exact Mass | 1178.71 |
| IUPAC Name | 5,10,15,20-tetrakis[4-[2-(2-methylpiperidin-1-yl)ethoxy]phenyl]-21,23-dihydroporphyrin |
| SMILES | CC1CCCCN1CCOc1ccc(-c2c3nc(c(-c4ccc(OCCN5CCCCC5C)cc4)c4ccc([nH]4)c(-c4ccc(OCCN5CCCCC5C)cc4)c4nc(c(-c5ccc(OCCN6CCCCC6C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C76H90N8O4/c1-53-13-5-9-41-81(53)45-49-85-61-25-17-57(18-26-61)73-65-33-35-67(77-65)74(58-19-27-62(28-20-58)86-50-46-82-42-10-6-14-54(82)2)69-37-39-71(79-69)76(60-23-31-64(32-24-60)88-52-48-84-44-12-8-16-56(84)4)72-40-38-70(80-72)75(68-36-34-66(73)78-68)59-21-29-63(30-22-59)87-51-47-83-43-11-7-15-55(83)3/h17-40,53-56,77,80H,5-16,41-52H2,1-4H3/b73-65-,73-66-,74-67-,74-69-,75-68-,75-70-,76-71-,76-72- |
| InChIKey | KZIPYMHAQUSGOR-HTTNFVRMSA-N |
| XLogP | 16.34 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1179.61 |
| LogP ≤ 5 | 16.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |