C22H25ClN4O2S — CID 155807000
N-tert-butyl-4-(5-chloro-2-methoxyanilino)-5-thia-3,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,11-tetraene-12-carboxamide (PubChem CID 155807000) has the molecular formula C22H25ClN4O2S and a molecular weight of 444.99 g/mol. Its IUPAC name is N-tert-butyl-4-(5-chloro-2-methoxyanilino)-5-thia-3,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,11-tetraene-12-carboxamide.
| Compound Name | N-tert-butyl-4-(5-chloro-2-methoxyanilino)-5-thia-3,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,11-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 155807000 |
| Molecular Formula | C22H25ClN4O2S |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-tert-butyl-4-(5-chloro-2-methoxyanilino)-5-thia-3,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,11-tetraene-12-carboxamide |
| SMILES | COc1ccc(Cl)cc1Nc1nc2c(s1)CCCc1cc(C(=O)NC(C)(C)C)[nH]c1-2 |
| InChI | InChI=1S/C22H25ClN4O2S/c1-22(2,3)27-20(28)15-10-12-6-5-7-17-19(18(12)24-15)26-21(30-17)25-14-11-13(23)8-9-16(14)29-4/h8-11,24H,5-7H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | GKXTYGNBQZAQFR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |