C19H17Cl2N3O3 — CID 155807194
(8aS)-4-(1,3-benzodioxol-5-yl)-3-(3,5-dichlorophenyl)-2,4,6,7,8,8a-hexahydropyrrolo[1,2-d][1,2,4]triazin-1-one (PubChem CID 155807194) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is (8aS)-4-(1,3-benzodioxol-5-yl)-3-(3,5-dichlorophenyl)-2,4,6,7,8,8a-hexahydropyrrolo[1,2-d][1,2,4]triazin-1-one.
| Compound Name | (8aS)-4-(1,3-benzodioxol-5-yl)-3-(3,5-dichlorophenyl)-2,4,6,7,8,8a-hexahydropyrrolo[1,2-d][1,2,4]triazin-1-one |
|---|---|
| PubChem CID | 155807194 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (8aS)-4-(1,3-benzodioxol-5-yl)-3-(3,5-dichlorophenyl)-2,4,6,7,8,8a-hexahydropyrrolo[1,2-d][1,2,4]triazin-1-one |
| SMILES | O=C1NN(c2cc(Cl)cc(Cl)c2)C(c2ccc3c(c2)OCO3)N2CCC[C@@H]12 |
| InChI | InChI=1S/C19H17Cl2N3O3/c20-12-7-13(21)9-14(8-12)24-19(23-5-1-2-15(23)18(25)22-24)11-3-4-16-17(6-11)27-10-26-16/h3-4,6-9,15,19H,1-2,5,10H2,(H,22,25)/t15-,19?/m0/s1 |
| InChIKey | QRFVGUJHBWPPLY-FUKCDUGKSA-N |
| XLogP | 3.74 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |