C27H26F2N4O6 — CID 155807409
N-[(3,5-difluorophenyl)methyl]-1-(3,4-dimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 155807409) has the molecular formula C27H26F2N4O6 and a molecular weight of 540.52 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-1-(3,4-dimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-1-(3,4-dimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155807409 |
| Molecular Formula | C27H26F2N4O6 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-1-(3,4-dimethoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)NCc3cc(F)cc(F)c3)nc2-c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H26F2N4O6/c1-35-20-7-6-19(13-21(20)36-2)33-26(16-10-22(37-3)24(39-5)23(11-16)38-4)31-25(32-33)27(34)30-14-15-8-17(28)12-18(29)9-15/h6-13H,14H2,1-5H3,(H,30,34) |
| InChIKey | GDKXWDJFYOVVTA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |