C24H18F4N4O4 — CID 155814846
N,1-bis(3,4-difluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 155814846) has the molecular formula C24H18F4N4O4 and a molecular weight of 502.42 g/mol. Its IUPAC name is N,1-bis(3,4-difluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N,1-bis(3,4-difluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155814846 |
| Molecular Formula | C24H18F4N4O4 |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | N,1-bis(3,4-difluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | COc1cc(-c2nc(C(=O)Nc3ccc(F)c(F)c3)nn2-c2ccc(F)c(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H18F4N4O4/c1-34-19-8-12(9-20(35-2)21(19)36-3)23-30-22(24(33)29-13-4-6-15(25)17(27)10-13)31-32(23)14-5-7-16(26)18(28)11-14/h4-11H,1-3H3,(H,29,33) |
| InChIKey | NUPUDJHFWQOFMM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |